462068-54-8 Usage
General Description
3-(2-Isopropyl-imidazol-1-yl)-propionic acid is a chemical compound that belongs to the class of imidazole-based drugs. It has a molecular formula C10H16N2O2 and a molecular weight of 200.247 g/mol. 3-(2-Isopropyl-imidazol-1-yl)-propionic acid is a derivative of propionic acid and is commonly used in pharmaceutical research and drug development. It has shown potential therapeutic effects, particularly in the treatment of inflammation-related disorders and neurological conditions. Additionally, its structural features make it a promising candidate for the development of new drugs with improved pharmacological properties. Further research and development of 3-(2-Isopropyl-imidazol-1-yl)-propionic acid may lead to the discovery of novel therapeutic agents for various medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 462068-54-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,6,2,0,6 and 8 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 462068-54:
(8*4)+(7*6)+(6*2)+(5*0)+(4*6)+(3*8)+(2*5)+(1*4)=148
148 % 10 = 8
So 462068-54-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H14N2O2/c1-7(2)9-10-4-6-11(9)5-3-8(12)13/h4,6-7H,3,5H2,1-2H3,(H,12,13)
