462095-37-0 Usage
Ethyl ester derivative
1H-Imidazole-4-carboxylic acid The compound is derived from 1H-imidazole-4-carboxylic acid by attaching an ethyl ester group.
Structural features
Formyl group and dihydro-2-oxo moiety The presence of a formyl group (-CHO) and a dihydro-2-oxo moiety (a five-membered imidazole ring with two hydrogen atoms and two oxygen atoms) contribute to its chemical properties and reactivity.
Heterocyclic carboxylic acid derivative
The compound contains a heterocyclic ring (a ring containing both carbon and non-carbon atoms) with a carboxylic acid functional group (-COOH).
Chemical applications
Organic synthesis The ethyl ester form of the compound makes it suitable for use in organic synthesis, allowing for the formation of various complex organic compounds.
Pharmaceutical applications
Building block for synthesis The compound can be used as a building block for the synthesis of other complex organic compounds, which may have potential pharmaceutical applications.
Potential biological or pharmacological properties
Due to its structural features, 1H-Imidazole-4-carboxylicacid,5-formyl-2,3-dihydro-2-oxo-,ethylester(9CI) may possess biological or pharmacological properties, making it a candidate for further research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 462095-37-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,6,2,0,9 and 5 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 462095-37:
(8*4)+(7*6)+(6*2)+(5*0)+(4*9)+(3*5)+(2*3)+(1*7)=150
150 % 10 = 0
So 462095-37-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O4/c1-2-13-6(11)5-4(3-10)8-7(12)9-5/h3H,2H2,1H3,(H2,8,9,12)
