463-15-0 Usage
Uses
Used in Chemical Research and Synthesis:
(E)-7-Cyano-2-heptene-4,6-diynoic acid is utilized as a key intermediate in the synthesis of a wide range of organic compounds. Its unique structure and reactivity make it a versatile building block for creating complex molecules with potential applications in various fields.
Used in Pharmaceutical Industry:
(E)-7-Cyano-2-heptene-4,6-diynoic acid may have potential applications in the pharmaceutical industry due to its unique chemical properties and reactivity. Its cyanide group and conjugated triple bond system could be harnessed to develop novel therapeutic agents or improve the synthesis of existing drugs.
Used in Organic Synthesis:
In the field of organic synthesis, (E)-7-Cyano-2-heptene-4,6-diynoic acid serves as a valuable starting material for the preparation of various organic compounds. Its reactivity and structural features make it an attractive candidate for the development of new synthetic routes and methodologies.
Overall, (E)-7-Cyano-2-heptene-4,6-diynoic acid is a crucial chemical compound with a broad spectrum of potential applications in research and industry, particularly in the areas of chemical research, pharmaceutical development, and organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 463-15-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,6 and 3 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 463-15:
(5*4)+(4*6)+(3*3)+(2*1)+(1*5)=60
60 % 10 = 0
So 463-15-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H3NO2/c9-7-5-3-1-2-4-6-8(10)11/h4,6H,(H,10,11)/b6-4+