4657-19-6 Usage
Chemical compound
A chemical compound with potential pharmaceutical and medicinal applications.
Derivative of imidazolidinethione
A heterocyclic compound with antimicrobial and antifungal properties.
Hydroxymethyl group
The presence of a hydroxymethyl group suggests that the compound may have a role in drug design and development.
Nitrofurfurylidene amino group
The presence of a nitrofurfurylidene amino group also suggests that the compound may have a role in drug design and development.
Potential as an antibacterial or antifungal agent
The compound's structure indicates that it may have potential as an antibacterial or antifungal agent.
Pharmaceutical industry candidate
It is a potential candidate for further research and development in the pharmaceutical industry.
Contribution to new drug development
Understanding its properties and potential applications can contribute to the development of new drugs for treating bacterial and fungal infections.
Check Digit Verification of cas no
The CAS Registry Mumber 4657-19-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,6,5 and 7 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4657-19:
(6*4)+(5*6)+(4*5)+(3*7)+(2*1)+(1*9)=106
106 % 10 = 6
So 4657-19-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N4O4S/c14-6-11-3-4-12(9(11)18)10-5-7-1-2-8(17-7)13(15)16/h1-2,5,14H,3-4,6H2/b10-5+
