467226-44-4 Usage
Uses
Used in Pharmaceutical Industry:
Benzenamine, 4-(1H-tetrazol-5-yloxy)(9CI) is used as a pharmaceutical intermediate for its potential biological activity. Its unique chemical structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Synthesis:
Due to its distinct chemical composition, Benzenamine, 4-(1H-tetrazol-5-yloxy)(9CI) is utilized as a building block in various chemical reactions and synthetic processes. Its versatility in forming different chemical entities makes it valuable in creating novel compounds with specific properties.
Further research is necessary to fully explore the potential uses and properties of Benzenamine, 4-(1H-tetrazol-5-yloxy)(9CI), as its current applications are based on its chemical structure and potential biological activity. As our understanding of Benzenamine, 4-(1H-tetrazol-5-yloxy)- (9CI) grows, so too may its applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 467226-44-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,6,7,2,2 and 6 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 467226-44:
(8*4)+(7*6)+(6*7)+(5*2)+(4*2)+(3*6)+(2*4)+(1*4)=164
164 % 10 = 4
So 467226-44-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H7N5O/c8-5-1-3-6(4-2-5)13-7-9-11-12-10-7/h1-4H,8H2,(H,9,10,11,12)
