470463-40-2 Usage
Uses
Used in Pharmaceutical Industry:
4-(3-Iodo-pyridin-2-yl)-morpholine is used as an intermediate in the synthesis of pharmaceuticals for its ability to contribute to the development of potential drug candidates. The presence of iodine and pyridinyl groups allows for the creation of molecules with specific biological activities, making it a valuable component in medicinal chemistry.
Used in Agrochemical Industry:
In the agrochemical sector, 4-(3-Iodo-pyridin-2-yl)-morpholine serves as an intermediate in the synthesis of agrochemicals, potentially leading to the development of new pesticides or other agricultural chemicals that can improve crop protection and yield.
Used in Medicinal Chemistry Research:
4-(3-Iodo-pyridin-2-yl)-morpholine is utilized as a building block in medicinal chemistry for its role in enhancing the pharmacokinetic properties of molecules. Its incorporation can lead to improved drug delivery, bioavailability, and overall therapeutic efficacy.
Used in Drug Discovery Research:
As a crucial component in drug discovery, 4-(3-Iodo-pyridin-2-yl)-morpholine aids researchers in the design and synthesis of new therapeutic agents, contributing to the advancement of treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 470463-40-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,0,4,6 and 3 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 470463-40:
(8*4)+(7*7)+(6*0)+(5*4)+(4*6)+(3*3)+(2*4)+(1*0)=142
142 % 10 = 2
So 470463-40-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H11IN2O/c10-8-2-1-3-11-9(8)12-4-6-13-7-5-12/h1-3H,4-7H2
