47087-37-6 Usage
Uses
Used in Organic Synthesis:
Z-D-Glu-OMe is used as a building block for the synthesis of various peptides and amino acid derivatives, contributing to the development of new compounds with potential applications in pharmaceuticals and other industries.
Used in Biochemical Research:
In biochemical research, Z-D-Glu-OMe is utilized for its role in the synthesis of complex molecules, aiding scientists in understanding the structure and function of biological systems.
Used as a Protecting Group in Peptide Synthesis:
Z-D-Glu-OMe is employed as a protecting group for the carboxyl group of glutamic acid during peptide synthesis. This function is crucial for preventing unwanted side reactions, ensuring the successful synthesis of desired peptide sequences.
Check Digit Verification of cas no
The CAS Registry Mumber 47087-37-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,7,0,8 and 7 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 47087-37:
(7*4)+(6*7)+(5*0)+(4*8)+(3*7)+(2*3)+(1*7)=136
136 % 10 = 6
So 47087-37-6 is a valid CAS Registry Number.
InChI:InChI=1S/C13H15NO6/c1-19-12(17)10(7-11(15)16)14-13(18)20-8-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,14,18)(H,15,16)/t10-/m1/s1
