4711-67-5 Usage
Uses
Used in Pharmaceutical Industry:
N-(2-Ethoxyphenyl)naphthalene-2-carboxamide is utilized as a pharmaceutical agent for its potential therapeutic effects. Given its structural components, it may interact with biological targets, offering opportunities for the development of new drugs or drug candidates.
Used in Agrochemical Industry:
In the agrochemical sector, N-(2-Ethoxyphenyl)naphthalene-2-carboxamide is employed as an active ingredient in pesticides or herbicides. Its specific chemical structure may confer properties that are effective against pests or unwanted plant species, contributing to crop protection.
Used in Materials Science:
N-(2-Ethoxyphenyl)naphthalene-2-carboxamide is also used in materials science for its potential to influence the properties of various materials. Its incorporation into polymers or other materials could enhance specific characteristics such as stability, reactivity, or conductivity, depending on the application.
Check Digit Verification of cas no
The CAS Registry Mumber 4711-67-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,1 and 1 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 4711-67:
(6*4)+(5*7)+(4*1)+(3*1)+(2*6)+(1*7)=85
85 % 10 = 5
So 4711-67-5 is a valid CAS Registry Number.
InChI:InChI=1/C19H17NO2/c1-2-22-18-10-6-5-9-17(18)20-19(21)16-12-11-14-7-3-4-8-15(14)13-16/h3-13H,2H2,1H3,(H,20,21)
