47163-83-7 Usage
General Description
(4-carbonochloridoylphenyl)-(4-carbonochloridoylphenyl)imino-oxido-azanium is a chemical compound with a complex structure containing both carbon, nitrogen, and oxygen atoms. The compound is a derivative of phenyl, and its structure includes chlorine atoms. It is also classified as an imino-oxido-azanium, indicating the presence of an imine and an oxido group, as well as a positively charged nitrogen atom. This chemical is likely to have various properties and potential applications in different fields, including pharmaceuticals, materials science, and organic synthesis. Overall, the compound's unique structure and properties make it an interesting subject for further study and potential utilization.
Check Digit Verification of cas no
The CAS Registry Mumber 47163-83-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,7,1,6 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 47163-83:
(7*4)+(6*7)+(5*1)+(4*6)+(3*3)+(2*8)+(1*3)=127
127 % 10 = 7
So 47163-83-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H8Cl2N2O3/c15-13(19)9-1-5-11(6-2-9)17-18(21)12-7-3-10(4-8-12)14(16)20/h1-8H/b18-17-
