473-69-8 Usage
General Description
2,2-Dimethylcyclobutane-1,3-dicarboxylic acid is a chemical compound that belongs to the class of cyclobutane carboxylic acids. It is a white crystalline solid with a molecular formula of C8H12O4 and a molecular weight of 172.18 g/mol. 2,2-Dimethylcyclobutane-1,3-dicarboxylic acid is primarily used in the production of pharmaceuticals and is also utilized as a building block in the synthesis of other organic compounds. Its unique structure and properties make it valuable for various chemical and pharmaceutical applications. Additionally, it has potential uses in the development of new materials and technologies, making it an important compound in the field of organic chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 473-69-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,7 and 3 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 473-69:
(5*4)+(4*7)+(3*3)+(2*6)+(1*9)=78
78 % 10 = 8
So 473-69-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H12O4/c1-8(2)4(6(9)10)3-5(8)7(11)12/h4-5H,3H2,1-2H3,(H,9,10)(H,11,12)/t4-,5+