473-69-8 Usage
Uses
Used in Pharmaceutical Production:
2,2-Dimethylcyclobutane-1,3-dicarboxylic acid is employed as a key component in the synthesis of various pharmaceuticals, contributing to the development of new drugs and medicines. Its unique chemical properties facilitate its integration into complex molecular structures, enhancing the therapeutic potential of the resulting pharmaceuticals.
Used in Organic Synthesis:
As a building block, 2,2-Dimethylcyclobutane-1,3-dicarboxylic acid is utilized in the synthesis of other organic compounds, playing a crucial role in the creation of a wide array of chemical products. Its versatility in chemical reactions allows for the production of diverse molecules with potential applications across various industries.
Used in Material Science:
2,2-Dimethylcyclobutane-1,3-dicarboxylic acid is also explored for its potential in the development of new materials and technologies. Its unique structure offers opportunities for the creation of innovative materials with improved properties, such as enhanced stability or novel functionalities, which could be applied in various fields, including electronics, energy, and advanced manufacturing.
Check Digit Verification of cas no
The CAS Registry Mumber 473-69-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,7 and 3 respectively; the second part has 2 digits, 6 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 473-69:
(5*4)+(4*7)+(3*3)+(2*6)+(1*9)=78
78 % 10 = 8
So 473-69-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H12O4/c1-8(2)4(6(9)10)3-5(8)7(11)12/h4-5H,3H2,1-2H3,(H,9,10)(H,11,12)/t4-,5+
