4750-56-5 Usage
Imidazole derivative
It is a compound derived from the imidazole ring structure, which is a five-membered ring system with one nitrogen atom and one double-bonded nitrogen atom.
Nitro group present
The compound contains a nitro group (-NO2), which is a functional group consisting of an oxygen-nitrogen-oxygen structure and is known for its reactivity and potential toxicity.
Methyl group present
The compound also contains a methyl group (-CH3), which is a simple alkyl group consisting of one carbon atom bonded to three hydrogen atoms.
Fungicidal properties
1-methyl-5-nitro-2-(2-phenylethenyl)imidazole is commonly used as a fungicide, meaning it is effective in controlling and preventing fungal infections.
Active ingredient in antifungal medications
The compound is used as an active ingredient in various antifungal medications for both human and veterinary use.
Inhibits fungal growth and cell membrane formation
The compound works by inhibiting the growth of fungi and preventing the formation of their cell membranes, thus disrupting their ability to survive and reproduce.
Broad-spectrum activity
1-methyl-5-nitro-2-(2-phenylethenyl)imidazole has a broad-spectrum of activity, meaning it is effective against a wide range of fungal species.
Agricultural applications
The compound is used in agriculture to protect crops from fungal infections, ensuring better crop yield and quality.
Potential pharmaceutical applications
1-methyl-5-nitro-2-(2-phenylethenyl)imidazole is being studied for its potential use in treating fungal infections in humans and animals.
Toxicity and safety concerns
The compound should be handled and used with caution, as it may be toxic if ingested or inhaled and can cause irritation to the skin and eyes.
Check Digit Verification of cas no
The CAS Registry Mumber 4750-56-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,5 and 0 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4750-56:
(6*4)+(5*7)+(4*5)+(3*0)+(2*5)+(1*6)=95
95 % 10 = 5
So 4750-56-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H11N3O2/c1-14-11(13-9-12(14)15(16)17)8-7-10-5-3-2-4-6-10/h2-9H,1H3
4750-56-5Relevant academic research and scientific papers
Method for promoting growth of poultry with 3-(5-nitro-2-imidazolyl)pyrazoles
-
, (2008/06/13)
There are disclosed novel 3-(5-nitro-2-imidazolyl)-pyrazoles exhibiting utility as antibacterial, antiprotozoal, and antifungal agents, making the compounds useful particularly in veterinary medicine, especially in controlling bacterial and protozoal infections of cattle, swine, and poultry. The compounds are also active as growth promoters in chickens.
