475112-25-5 Usage
Uses
Used in Pharmaceutical Industry:
4-ISOTHIAZOLECARBOXYLIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to modulate biological activities. Its unique structure allows it to be incorporated into drug molecules, potentially enhancing their therapeutic effects and targeting specific biological pathways.
Used in Agrochemical Industry:
In the agrochemical sector, 4-ISOTHIAZOLECARBOXYLIC ACID is utilized as a building block in the development of agrochemicals. Its chemical properties make it suitable for the creation of compounds that can be used in pest control and crop protection, contributing to more effective and targeted agricultural solutions.
Used in Chemical Compound Production:
4-ISOTHIAZOLECARBOXYLIC ACID serves as a fundamental component in the production of other chemical compounds. Its versatility in chemical reactions and compatibility with a range of other molecules make it an essential precursor in the synthesis of various organic and inorganic compounds for diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 475112-25-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,5,1,1 and 2 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 475112-25:
(8*4)+(7*7)+(6*5)+(5*1)+(4*1)+(3*2)+(2*2)+(1*5)=135
135 % 10 = 5
So 475112-25-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H3NO2S/c6-4(7)3-1-5-8-2-3/h1-2H,(H,6,7)
475112-25-5Relevant articles and documents
Process for obtaining compounds usable in the production of cefotetan, and new compounds obtained thereby
-
Example 1, (2010/01/31)
A process for obtaining salts of 4-carboxy-3-hydroxy-5-mercapto-isothiazole which are compounds usable in the production of Cefotetan, and new compounds obtained thereby, in which R1 = R2 = R3 = Na or K; R1 = Na or K and R2 = R3 = H; or R1 = R2 = Na or K and R3 = H.
