475653-05-5 Usage
Uses
Used in Pharmaceutical Industry:
4-(3,5-Dichloro-phenyl)-piperidine is used as an intermediate in the synthesis of pharmaceutical drugs due to its potential as a pharmacophore and its unique reactivity and pharmacological properties. It plays a crucial role in the development of new medications, contributing to the advancement of healthcare and treatment options.
Used in Agrochemical Industry:
4-(3,5-Dichloro-phenyl)-piperidine is also utilized as an intermediate in the synthesis of agrochemicals. Its chemical properties and structure make it a valuable component in the creation of various agricultural products, such as pesticides and herbicides, which are essential for crop protection and ensuring food security.
Check Digit Verification of cas no
The CAS Registry Mumber 475653-05-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,5,6,5 and 3 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 475653-05:
(8*4)+(7*7)+(6*5)+(5*6)+(4*5)+(3*3)+(2*0)+(1*5)=175
175 % 10 = 5
So 475653-05-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H13Cl2N/c12-10-5-9(6-11(13)7-10)8-1-3-14-4-2-8/h5-8,14H,1-4H2
