477593-22-9 Usage
Uses
As of the current state of knowledge, the specific applications of 1-(5-bromo-2-chloropyrimidin-4-yl)piperidin-4-ol are not well-documented in the scientific literature. However, given its structural features and the properties of related compounds, it can be hypothesized that 1-(5-bromo-2-chloropyrimidin-4-yl)piperidin-4-ol may have potential uses in various fields, pending further research and development. Possible areas of application could include pharmaceutical development, where its bioactivity and the presence of potentially reactive groups might be exploited in the synthesis of new drugs or drug delivery systems. Additionally, its chemical properties could be of interest in the field of organic chemistry for the synthesis of more complex molecules or as intermediates in chemical reactions.
Used in Pharmaceutical Development:
1-(5-bromo-2-chloropyrimidin-4-yl)piperidin-4-ol could be used as a building block or intermediate in the synthesis of new pharmaceutical compounds, leveraging its bioactivity and the reactivity of its bromine and chlorine atoms.
Used in Organic Chemistry:
1-(5-bromo-2-chloropyrimidin-4-yl)piperidin-4-ol could serve as a reagent or intermediate in the synthesis of more complex organic molecules, taking advantage of its potential reactivity in chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 477593-22-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,7,5,9 and 3 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 477593-22:
(8*4)+(7*7)+(6*7)+(5*5)+(4*9)+(3*3)+(2*2)+(1*2)=199
199 % 10 = 9
So 477593-22-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BrClN3O/c10-7-5-12-9(11)13-8(7)14-3-1-6(15)2-4-14/h5-6,15H,1-4H2
