47818-40-6 Usage
General Description
6-(9-Carboxy-1-nonenyl)-4,5-dihexylcyclohex-2-ene-1-octanoic acid is a chemical compound with a long and complex molecular structure. It is a type of fatty acid, containing carboxyl and nonenyl groups, as well as multiple hexyl and octanoic groups. 6-(9-Carboxy-1-nonenyl)-4,5-dihexylcyclohex-2-ene-1-octanoic acid is likely derived from natural sources and may have potential applications in various industries, such as pharmaceuticals, cosmetics, and food additives. Its specific properties and potential uses would need to be further studied and determined through research and testing.
Check Digit Verification of cas no
The CAS Registry Mumber 47818-40-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,7,8,1 and 8 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 47818-40:
(7*4)+(6*7)+(5*8)+(4*1)+(3*8)+(2*4)+(1*0)=146
146 % 10 = 6
So 47818-40-6 is a valid CAS Registry Number.
InChI:InChI=1/C36H64O4/c1-3-5-7-17-23-31-29-30-32(24-18-13-12-16-22-28-36(39)40)34(33(31)25-19-8-6-4-2)26-20-14-10-9-11-15-21-27-35(37)38/h20,26,29-34H,3-19,21-25,27-28H2,1-2H3,(H,37,38)(H,39,40)/b26-20+