478829-34-4 Usage
Uses
Used in Pharmaceutical Research and Development:
1H-Indazole-5-carboxamide(9CI) is used as a chemical intermediate for the synthesis of heterocyclic compounds with potential therapeutic applications. Its unique structure and properties make it a valuable component in the development of new drugs.
Used in Antimicrobial Applications:
1H-Indazole-5-carboxamide(9CI) is used as an antimicrobial agent for the development of drugs targeting various infectious diseases. Its ability to modulate biological pathways and cellular processes contributes to its potential as an effective antimicrobial compound.
Used in Antiviral Applications:
1H-Indazole-5-carboxamide(9CI) is used as an antiviral agent in the development of drugs to combat viral infections. Its potential to interfere with viral replication and other biological processes makes it a promising candidate for antiviral drug development.
Used in Anticancer Applications:
1H-Indazole-5-carboxamide(9CI) is used as an anticancer agent in the development of drugs for the treatment of various types of cancer. Its potential to modulate cellular processes and biological pathways involved in cancer progression and growth makes it a valuable compound in cancer research and drug discovery.
Overall, 1H-Indazole-5-carboxamide(9CI) is a versatile chemical with diverse potential applications in medicinal chemistry and drug discovery, particularly in the development of antimicrobial, antiviral, and anticancer agents. Its unique structure and properties make it a valuable building block for the synthesis of heterocyclic compounds with therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 478829-34-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,8,8,2 and 9 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 478829-34:
(8*4)+(7*7)+(6*8)+(5*8)+(4*2)+(3*9)+(2*3)+(1*4)=214
214 % 10 = 4
So 478829-34-4 is a valid CAS Registry Number.
InChI:InChI=1/C8H7N3O/c9-8(12)5-1-2-7-6(3-5)4-10-11-7/h1-4H,(H2,9,12)(H,10,11)
