479-73-2 Usage
Uses
Used in Histology:
Pararosaniline is used as a histological dye for staining purposes. Its application reason is to provide clear and distinct visualization of cellular structures and tissues in microscopic examination.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, pararosaniline is used as an intermediate in the synthesis of various pharmaceutical compounds. Its application reason is due to its chemical properties, which allow for the creation of a wide range of medications.
Used in Chemical Research:
Pararosaniline is also utilized in chemical research as a reagent for various analytical and experimental procedures. Its application reason is its unique chemical structure, which enables it to participate in specific chemical reactions and provide valuable insights into the behavior of different compounds.
Used in Textile Industry:
In the textile industry, pararosaniline is used as a dye for coloring fabrics. Its application reason is its ability to produce vibrant and long-lasting colors, making it a popular choice for various textile applications.
Used in Analytical Chemistry:
Pararosaniline is employed as an indicator in analytical chemistry, particularly in titrations. Its application reason is its color-changing properties, which allow for the accurate determination of endpoint concentrations in various chemical analyses.
Check Digit Verification of cas no
The CAS Registry Mumber 479-73-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,7 and 9 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 479-73:
(5*4)+(4*7)+(3*9)+(2*7)+(1*3)=92
92 % 10 = 2
So 479-73-2 is a valid CAS Registry Number.
InChI:InChI=1/C19H17N3.C2H4O2/c20-16-7-1-13(2-8-16)19(14-3-9-17(21)10-4-14)15-5-11-18(22)12-6-15;1-2(3)4/h1-12,20H,21-22H2;1H3,(H,3,4)
479-73-2Relevant academic research and scientific papers
DYES OF IMPROVED OPTICAL BRIGHTNESS AND/OR FLUORESCENCE AND COMPOSITIONS CONTAINING THEM
-
, (2009/04/24)
Preparing dyes suitable for cosmetic use that start with known dyes and link them, for example, with 1,3,5 triazine to bulky organic groups that control solubility.
