479028-67-6 Usage
Uses
Used in Pharmaceutical Industry:
6-FLUOROBENZO[D]THIAZOLE-2-CARBOXYLIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows for the development of new drugs with specific therapeutic properties.
Used in Agrochemical Industry:
In the agrochemical industry, 6-FLUOROBENZO[D]THIAZOLE-2-CARBOXYLIC ACID serves as an intermediate for the production of agrochemicals, potentially leading to the creation of new pesticides or herbicides with improved efficacy and selectivity.
Used in Materials Science:
6-FLUOROBENZO[D]THIAZOLE-2-CARBOXYLIC ACID is used in materials science for the development of novel materials with specific properties, such as improved stability or reactivity, due to its unique chemical structure.
Used in Organic Electronics:
6-FLUOROBENZO[D]THIAZOLE-2-CARBOXYLIC ACID is utilized in the field of organic electronics, where its electronic properties can be harnessed for the development of new electronic devices or components, such as organic light-emitting diodes (OLEDs) or organic solar cells.
Used in Biological Research:
6-FLUOROBENZO[D]THIAZOLE-2-CARBOXYLIC ACID may be studied for its potential biological activity in biological research. Its effects on living organisms could lead to new insights or applications in medicine or biology.
Check Digit Verification of cas no
The CAS Registry Mumber 479028-67-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,9,0,2 and 8 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 479028-67:
(8*4)+(7*7)+(6*9)+(5*0)+(4*2)+(3*8)+(2*6)+(1*7)=186
186 % 10 = 6
So 479028-67-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H4FNO2S/c9-4-1-2-5-6(3-4)13-7(10-5)8(11)12/h1-3H,(H,11,12)
