479064-95-4 Usage
General Description
FMOC-(R)-3-AMINO-3-(4-FLUORO-PHENYL)-PROPIONIC ACID, often simply referred to as FMOC, is a type of chemical reagent used in the field of organic chemistry. This specific reagent is mostly used in the synthesis of peptides, which are short chains of amino acid monomers linked by peptide bonds. The (R)-3-AMINO-3-(4-FLUORO-PHENYL)-PROPIONIC acid component suggests the presence of a fluorine atom, indicating that this reagent may have unique characteristics, such as relative stability or specific reactivity. As an FMOC-protected amino acid, it's particularly suited to solid-phase peptide synthesis methods, which protect specific functional groups to prevent unwanted side reactions during the synthesis process. However, as a chemical reagent, FMOC is not intended for use outside of a controlled laboratory environment due to potential health risks if improperly handled.
Check Digit Verification of cas no
The CAS Registry Mumber 479064-95-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,9,0,6 and 4 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 479064-95:
(8*4)+(7*7)+(6*9)+(5*0)+(4*6)+(3*4)+(2*9)+(1*5)=194
194 % 10 = 4
So 479064-95-4 is a valid CAS Registry Number.
InChI:InChI=1/C24H20FNO4/c25-16-11-9-15(10-12-16)22(13-23(27)28)26-24(29)30-14-21-19-7-3-1-5-17(19)18-6-2-4-8-20(18)21/h1-12,21-22H,13-14H2,(H,26,29)(H,27,28)/t22-/m1/s1