47922-48-5 Usage
General Description
PYR-HIS-TRP-SER-TYR-GLY-LEU-GLN-PRO-GLY-NH2 is a chemical compound comprised of a series of amino acids including pyroglutamic acid (PYR), histidine (HIS), tryptophan (TRP), serine (SER), tyrosine (TYR), glycine (GLY), leucine (LEU), glutamine (GLN), proline (PRO), and the amide group (NH2). PYR-HIS-TRP-SER-TYR-GLY-LEU-GLN-PRO-GLY-NH2 is a peptide with the sequence of these amino acids and is often used in research and studies related to proteins and peptides. It has the potential to have various physiological and biochemical effects due to the specific arrangement and combination of amino acids within the peptide.
Check Digit Verification of cas no
The CAS Registry Mumber 47922-48-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,7,9,2 and 2 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 47922-48:
(7*4)+(6*7)+(5*9)+(4*2)+(3*2)+(2*4)+(1*8)=145
145 % 10 = 5
So 47922-48-5 is a valid CAS Registry Number.
InChI:InChI=1/C54H71N15O14/c1-28(2)18-37(49(78)64-36(13-15-43(55)72)54(83)69-17-5-8-42(69)53(82)59-24-44(56)73)63-46(75)25-60-47(76)38(19-29-9-11-32(71)12-10-29)65-52(81)41(26-70)68-50(79)39(20-30-22-58-34-7-4-3-6-33(30)34)66-51(80)40(21-31-23-57-27-61-31)67-48(77)35-14-16-45(74)62-35/h3-4,6-7,9-12,22-23,27-28,35-42,58,70-71H,5,8,13-21,24-26H2,1-2H3,(H2,55,72)(H2,56,73)(H,57,61)(H,59,82)(H,60,76)(H,62,74)(H,63,75)(H,64,78)(H,65,81)(H,66,80)(H,67,77)(H,68,79)/t35-,36-,37-,38-,39-,40-,41-,42-/m0/s1