4794-81-4 Usage
Uses
Used in Pharmaceutical Applications:
2,4,6-triethylphenyl(imino)imidazolidine is utilized as a building block in the synthesis of other compounds, particularly in the pharmaceutical industry. Its unique structure allows for the creation of new molecules with potential therapeutic properties, making it a valuable component in drug development.
Used in Chemical Synthesis:
In the chemical industry, 2,4,6-triethylphenyl(imino)imidazolidine serves as a key intermediate in the synthesis of various organic compounds. Its versatile structure enables the formation of a wide range of products, including specialty chemicals and advanced materials.
Used in Material Production:
2,4,6-triethylphenyl(imino)imidazolidine is also employed as a component in the production of certain types of materials. Its unique chemical properties contribute to the development of innovative materials with specific characteristics, such as improved stability or enhanced performance in various applications.
Used in Biological and Pharmacological Research:
The potential biological and pharmacological properties of 2,4,6-triethylphenyl(imino)imidazolidine are being actively researched for possible therapeutic uses. Its unique structure and properties may offer new avenues for the development of novel treatments and therapies in the medical field.
Check Digit Verification of cas no
The CAS Registry Mumber 4794-81-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,7,9 and 4 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 4794-81:
(6*4)+(5*7)+(4*9)+(3*4)+(2*8)+(1*1)=124
124 % 10 = 4
So 4794-81-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H23N3/c1-4-11-9-12(5-2)14(13(6-3)10-11)18-8-7-17-15(18)16/h9-10H,4-8H2,1-3H3,(H2,16,17)
