4800-53-7 Usage
Chemical structure
Quinoline derivative with a sulfur atom attached to the second carbon of the quinoline ring
Functional groups
Ethyl group, methoxy group, and thiol group
Biological activities
Antiviral, antibacterial, antifungal, and antitumor properties
Applications
a. Synthesis of pharmaceutical drugs and agrochemicals
b. Preparation of heterocyclic compounds
c. Ligand in coordination chemistry
Additional uses
a. Corrosion inhibitor for metals
b. Fluorescence probe for the detection of various metal ions
Check Digit Verification of cas no
The CAS Registry Mumber 4800-53-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,0 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 4800-53:
(6*4)+(5*8)+(4*0)+(3*0)+(2*5)+(1*3)=77
77 % 10 = 7
So 4800-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NOS/c1-3-13-11-6-5-10(14-2)8-9(11)4-7-12(13)15/h4-8H,3H2,1-2H3
