480424-51-9 Usage
General Description
2-BUTOXY-3-FORMYL-5-METHYLPHENYLBORONIC is a chemical compound, but there is very limited publicly available information about its specific properties or uses. Phenylboronic acids, which this compound appears to be a type of, are often used in organic chemistry for various purposes, such as in the Suzuki reaction. Methyl groups, such as the one in this compound, can generally increase the lipophilicity of a molecule and potentially increase its ability to pass through lipid membranes. However, without more specific information, it's difficult to say more about this particular compound. It's recommended to handle such chemicals with care and use appropriate safety measures.
Check Digit Verification of cas no
The CAS Registry Mumber 480424-51-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,2 and 4 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 480424-51:
(8*4)+(7*8)+(6*0)+(5*4)+(4*2)+(3*4)+(2*5)+(1*1)=139
139 % 10 = 9
So 480424-51-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H17BO4/c1-3-4-5-17-12-10(8-14)6-9(2)7-11(12)13(15)16/h6-8,15-16H,3-5H2,1-2H3
