480424-51-9 Usage
Uses
Used in Organic Chemistry:
2-BUTOXY-3-FORMYL-5-METHYLPHENYLBORONIC is used as a reagent in organic chemistry for various purposes. Its phenylboronic acid structure makes it a candidate for reactions such as the Suzuki reaction, which is a cross-coupling reaction between an organoboronic acid and an organohalide or triflate to form carbon-carbon bonds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-BUTOXY-3-FORMYL-5-METHYLPHENYLBORONIC may be used as a building block or intermediate in the synthesis of complex molecules, including potential drug candidates. Its lipophilic nature, due to the methyl group, could facilitate its interaction with biological targets and improve its pharmacokinetic properties.
Used in Material Science:
2-BUTOXY-3-FORMYL-5-METHYLPHENYLBORONIC could also be employed in material science for the development of new materials with specific properties. Its chemical structure may contribute to the formation of novel compounds with applications in areas such as electronics, sensors, or advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 480424-51-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,2 and 4 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 480424-51:
(8*4)+(7*8)+(6*0)+(5*4)+(4*2)+(3*4)+(2*5)+(1*1)=139
139 % 10 = 9
So 480424-51-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H17BO4/c1-3-4-5-17-12-10(8-14)6-9(2)7-11(12)13(15)16/h6-8,15-16H,3-5H2,1-2H3
