480424-55-3 Usage
General Description
2-FORMYL-2-METHOXY-5-METHYLBORONIC ACID is a compound that contains a boronic acid group, a formyl group, a methoxy group, and a methyl group. It is a versatile building block in organic chemistry and pharmaceutical synthesis. 2-FORMYL-2-METHOXY-5-METHYLBORONIC ACID can be used as a reagent in organic reactions such as Suzuki coupling and palladium-catalyzed cross-coupling reactions to form carbon-carbon bonds. Its boronic acid group also makes it useful in the development of new pharmaceuticals, as it can bind to specific biological targets. Additionally, the presence of a formyl group and a methoxy group makes it a potential intermediate for the synthesis of various heterocyclic compounds and natural products.
Check Digit Verification of cas no
The CAS Registry Mumber 480424-55-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,2 and 4 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 480424-55:
(8*4)+(7*8)+(6*0)+(5*4)+(4*2)+(3*4)+(2*5)+(1*5)=143
143 % 10 = 3
So 480424-55-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BO4/c1-6-3-7(5-11)9(14-2)8(4-6)10(12)13/h3-5,12-13H,1-2H3