480424-55-3 Usage
Uses
Used in Organic Chemistry:
2-FORMYL-2-METHOXY-5-METHYLBORONIC ACID is utilized as a reagent in various organic reactions, particularly in Suzuki coupling and palladium-catalyzed cross-coupling reactions. It facilitates the formation of carbon-carbon bonds, which are crucial for constructing complex organic molecules and advancing chemical synthesis processes.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2-FORMYL-2-METHOXY-5-METHYLBORONIC ACID is employed as a key intermediate for the development of new drugs. Its boronic acid group allows it to bind to specific biological targets, making it a promising candidate for the creation of targeted therapeutic agents.
Used in the Synthesis of Heterocyclic Compounds and Natural Products:
The presence of a formyl group and a methoxy group in 2-FORMYL-2-METHOXY-5-METHYLBORONIC ACID renders it a potential intermediate for the synthesis of a variety of heterocyclic compounds and natural products. This versatility makes it an essential component in the development of novel chemical entities with potential applications in various fields, including medicine, agrochemistry, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 480424-55-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,2 and 4 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 480424-55:
(8*4)+(7*8)+(6*0)+(5*4)+(4*2)+(3*4)+(2*5)+(1*5)=143
143 % 10 = 3
So 480424-55-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H11BO4/c1-6-3-7(5-11)9(14-2)8(4-6)10(12)13/h3-5,12-13H,1-2H3
