480424-78-0 Usage
Uses
Used in Chemical Synthesis:
(4-(1-PYRROLIDINYLMETHYL)PHENYL)MAGNESIUM is used as a reagent in the combinatorial preparation of rosamine derivatives, which are applicable as fluorescent probes in monitoring cellular glutathione (GSH) levels. (4-(1-PYRROLIDINYLMETHYL)PHENYL)MAGNESI&'s unique structure allows for the efficient synthesis of these derivatives, making it a valuable tool in the development of new fluorescent probes for cellular research.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, (4-(1-PYRROLIDINYLMETHYL)PHENYL)MAGNESIUM is used as a key intermediate in the synthesis of 4,5-disubstituted-2-aminoimidazole-triazole derivatives. These derivatives have been found to possess antibiofilm activity, making them potential candidates for the development of new antimicrobial agents to combat biofilm-related infections.
Used in Research and Development:
(4-(1-PYRROLIDINYLMETHYL)PHENYL)MAGNESIUM is also utilized in research and development for the exploration of new chemical reactions and the synthesis of novel compounds with potential applications in various fields, such as materials science, pharmaceuticals, and chemical engineering. Its reactivity and unique structure make it an attractive candidate for the development of new synthetic methods and the discovery of new compounds with specific properties and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 480424-78-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,2 and 4 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 480424-78:
(8*4)+(7*8)+(6*0)+(5*4)+(4*2)+(3*4)+(2*7)+(1*8)=150
150 % 10 = 0
So 480424-78-0 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N.BrH.Mg/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;;/h2-3,6-7H,4-5,8-10H2;1H;/q-1;;+2/p-1
