480424-79-1 Usage
General Description
The chemical (3-(1-pyrrolidinylmethyl)phenyl)magnesium is a complex organometallic compound containing a magnesium atom bonded to a phenyl ring with a 1-pyrrolidinylmethyl group attached. It is commonly used in organic synthesis as a powerful and versatile nucleophile for forming carbon-carbon bonds. The presence of the magnesium atom increases the reactivity of the compound, allowing it to participate in a wide range of reactions such as Grignard reactions, nucleophilic additions, and ketone reductions. Additionally, (3-(1-pyrrolidinylmethyl)phenyl)magnesium is a key reagent in the field of organometallic chemistry, facilitating the formation of complex organic molecules with high efficiency and selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 480424-79-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,2 and 4 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 480424-79:
(8*4)+(7*8)+(6*0)+(5*4)+(4*2)+(3*4)+(2*7)+(1*9)=151
151 % 10 = 1
So 480424-79-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H14N.BrH.Mg/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;;/h1-2,6-7H,4-5,8-10H2;1H;/q;;+1/p-1/rC11H14BrMgN/c12-13-11-5-3-4-10(8-11)9-14-6-1-2-7-14/h3-5,8H,1-2,6-7,9H2