480424-82-6 Usage
General Description
The chemical compound "(3-(1-piperidinylmethyl)phenyl)magnesium" is a complex organic compound that contains a phenyl group attached to a magnesium atom. The compound also features a piperidinylmethyl group linked to the phenyl ring. This structure makes it useful for various reactions in organic synthesis, particularly in Grignard reactions where the magnesium atom acts as a nucleophile to form new carbon-carbon bonds. Additionally, the piperidinylmethyl group can provide additional reactivity and selectivity in certain chemical reactions. Overall, this compound has potential applications in the development of new organic molecules and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 480424-82-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,2 and 4 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 480424-82:
(8*4)+(7*8)+(6*0)+(5*4)+(4*2)+(3*4)+(2*8)+(1*2)=146
146 % 10 = 6
So 480424-82-6 is a valid CAS Registry Number.
InChI:InChI=1/C12H16N.BrH.Mg/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;/h1,3,7-8H,2,5-6,9-11H2;1H;/q;;+1/p-1/rC12H16BrMgN/c13-14-12-6-4-5-11(9-12)10-15-7-2-1-3-8-15/h4-6,9H,1-3,7-8,10H2