480438-59-3 Usage
Uses
Used in Pharmaceutical Industry:
4-FLUORO-2-ISOPROPOXYPHENYLBORONIC ACID is used as a reagent in the synthesis of various pharmaceuticals. Its unique structure allows for the creation of new drug molecules with potential therapeutic applications.
Used in Agrochemical Industry:
4-FLUORO-2-ISOPROPOXYPHENYLBORONIC ACID is also utilized in the preparation of agrochemicals, contributing to the development of new pesticides and other agricultural products to improve crop protection and yield.
Used in Medicinal Chemistry Research:
4-FLUORO-2-ISOPROPOXYPHENYLBORONIC ACID serves as a valuable building block in medicinal chemistry, aiding researchers in the design and synthesis of innovative drugs that target specific biological pathways, potentially leading to more effective treatments for various diseases.
Used in Materials Science:
Due to its distinct chemical properties, 4-FLUORO-2-ISOPROPOXYPHENYLBORONIC ACID has potential applications in materials science, where it could be employed to develop new materials with unique properties for various industrial applications.
Used in Catalysis:
4-FLUORO-2-ISOPROPOXYPHENYLBORONIC ACID's chemical characteristics also make it a candidate for use in catalysis, where it could enhance the efficiency of chemical reactions in various industrial processes.
Check Digit Verification of cas no
The CAS Registry Mumber 480438-59-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,3 and 8 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 480438-59:
(8*4)+(7*8)+(6*0)+(5*4)+(4*3)+(3*8)+(2*5)+(1*9)=163
163 % 10 = 3
So 480438-59-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BFO3/c1-6(2)14-9-5-7(11)3-4-8(9)10(12)13/h3-6,12-13H,1-2H3
