480438-61-7 Usage
Uses
Used in Pharmaceutical Synthesis:
2-Butoxy-4-Fluorophenylboronic Acid is employed as a reagent in the synthesis of various pharmaceutical and biological molecules. Its reactivity and solubility properties facilitate coupling reactions, making it a valuable component in the development of new drugs and therapeutic agents.
Used in Materials Science:
In the realm of materials science, 2-Butoxy-4-Fluorophenylboronic Acid is utilized for its potential applications in the creation of novel materials with specific properties. Its chemical structure and reactivity contribute to the design and synthesis of advanced materials with tailored characteristics for various applications.
Used in Nanotechnology:
2-Butoxy-4-Fluorophenylboronic Acid also finds use in nanotechnology, where its unique properties can be harnessed to develop nanoscale materials and devices. 2-BUTOXY-4-FLUOROPHENYLBORONIC ACID's reactivity and solubility play a crucial role in the assembly and functionalization of nanostructures, paving the way for innovative applications in areas such as electronics, medicine, and energy.
Check Digit Verification of cas no
The CAS Registry Mumber 480438-61-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,3 and 8 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 480438-61:
(8*4)+(7*8)+(6*0)+(5*4)+(4*3)+(3*8)+(2*6)+(1*1)=157
157 % 10 = 7
So 480438-61-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BFO3/c1-2-3-6-15-10-7-8(12)4-5-9(10)11(13)14/h4-5,7,13-14H,2-3,6H2,1H3
