480438-62-8 Usage
Uses
Used in Organic Synthesis:
2-Butoxy-5-fluorophenylboronic acid is used as a building block in organic synthesis for the creation of various complex organic molecules. Its reactivity and functional groups allow for the formation of new chemical bonds and the synthesis of a wide range of compounds.
Used in Cross-Coupling Reactions:
In cross-coupling reactions, 2-Butoxy-5-fluorophenylboronic acid serves as a valuable reagent. It facilitates the formation of carbon-carbon or carbon-heteroatom bonds, which are crucial for the synthesis of diverse organic compounds and materials.
Used in Medicinal and Pharmaceutical Research:
2-Butoxy-5-fluorophenylboronic acid is used as a reagent in medicinal and pharmaceutical research. Its ability to form stable complexes with biological molecules makes it a promising tool in drug discovery and development. Researchers can utilize 2-Butoxy-5-fluorophenylboronic acid to design and synthesize new drugs with potential therapeutic applications.
Used in Drug Discovery and Development:
In the field of drug discovery and development, 2-Butoxy-5-fluorophenylboronic acid is employed for its potential to interact with biological targets. Its unique structure allows it to modulate the activity of proteins, enzymes, or receptors, contributing to the development of novel therapeutic agents.
Used in the Development of New Materials and Catalysts:
2-Butoxy-5-fluorophenylboronic acid is also used in the development of new materials and catalysts across various industries. Its unique properties make it a promising candidate for creating innovative materials with specific characteristics, such as improved catalytic activity or enhanced stability.
Check Digit Verification of cas no
The CAS Registry Mumber 480438-62-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,3 and 8 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 480438-62:
(8*4)+(7*8)+(6*0)+(5*4)+(4*3)+(3*8)+(2*6)+(1*2)=158
158 % 10 = 8
So 480438-62-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BFO3/c1-2-3-6-15-10-5-4-8(12)7-9(10)11(13)14/h4-5,7,13-14H,2-3,6H2,1H3
