480438-63-9 Usage
Uses
Used in Pharmaceutical Synthesis:
5-Fluoro-2-isopropoxyphenylboronic acid is used as a building block for the synthesis of pharmaceuticals, leveraging its boronic acid functionality to participate in Suzuki-Miyaura cross-coupling reactions. This allows for the formation of carbon-carbon bonds, facilitating the creation of complex molecular structures essential in the development of new drugs.
Used in Agrochemical Development:
In the agrochemical industry, 5-Fluoro-2-isopropoxyphenylboronic acid serves as a key intermediate in the synthesis of various agrochemicals. Its reactivity in cross-coupling reactions contributes to the development of new compounds with potential applications in crop protection and pest control.
Used in Material Science:
5-Fluoro-2-isopropoxyphenylboronic acid is utilized in the development of new materials, where its unique structure and reactivity are harnessed to create novel compounds with specific properties. These materials can find applications in various fields, such as electronics, coatings, and advanced materials for specialized industries.
Overall, 5-fluoro-2-isopropoxyphenylboronic acid's diverse applications across different industries highlight its significance as a valuable tool in organic synthesis, pharmaceutical development, agrochemical innovation, and material science.
Check Digit Verification of cas no
The CAS Registry Mumber 480438-63-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,3 and 8 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 480438-63:
(8*4)+(7*8)+(6*0)+(5*4)+(4*3)+(3*8)+(2*6)+(1*3)=159
159 % 10 = 9
So 480438-63-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BFO3/c1-6(2)14-9-4-3-7(11)5-8(9)10(12)13/h3-6,12-13H,1-2H3
