480439-03-0 Usage
Highly reactive
The compound is highly reactive due to the presence of the isocyanate group, which allows it to readily react with various substrates to form strong and durable bonds.
Common uses
Polyurethane foams and coatings 2,6-Dichlorophenethyl isocyanate 97 is commonly used in the production of polyurethane foams and coatings, which are widely used in various industries due to their excellent properties, such as insulation, flexibility, and durability.
Cross-linking agent
The isocyanate group in the compound acts as a powerful cross-linking agent, enabling it to form strong chemical bonds with other molecules, which contributes to the strength and durability of the final product.
Potent irritant
2,6-Dichlorophenethyl isocyanate 97 is known to be a potent irritant, which means it can cause significant irritation to the skin, eyes, and respiratory system upon exposure.
Sensitizer
The compound is also a sensitizer, which means it can cause allergic reactions and sensitization in some individuals upon repeated exposure.
Health risks
The chemical poses health risks to both workers and consumers, including respiratory issues, skin irritation, and potential allergic reactions.
Proper handling and protective measures
To minimize the risk of exposure and potential adverse health effects, it is essential to follow proper handling procedures and use appropriate personal protective equipment (PPE) when working with 2,6-Dichlorophenethyl isocyanate 97. This may include wearing gloves, safety goggles, and a respirator, as well as following safety guidelines and regulations for handling hazardous chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 480439-03-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,3 and 9 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 480439-03:
(8*4)+(7*8)+(6*0)+(5*4)+(4*3)+(3*9)+(2*0)+(1*3)=150
150 % 10 = 0
So 480439-03-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7Cl2NO/c10-8-2-1-3-9(11)7(8)4-5-12-6-13/h1-3H,4-5H2
