4812-29-7 Usage
Uses
Used in Pharmaceutical Applications:
3,6-Dimethyloctanoic acid is used as a pharmaceutical agent for its potential role in lipid metabolism and energy production. Its unique chemical structure allows it to interact with biological systems, making it a promising candidate for the development of new drugs and therapies.
Used in Industrial Applications:
In the industrial sector, 3,6-Dimethyloctanoic acid is used as a raw material for the synthesis of various chemical compounds and products. Its unique properties make it suitable for use in the production of plastics, lubricants, and other materials.
Used in Flavor and Fragrance Industry:
3,6-Dimethyloctanoic acid is used as a flavor and fragrance ingredient due to its unique scent and taste profile. It is commonly used in the formulation of perfumes, cosmetics, and food products to provide a distinct and pleasant aroma.
Used in Energy Production:
3,6-Dimethyloctanoic acid plays a role in energy production, as it is involved in lipid metabolism. This makes it a potential candidate for the development of new energy sources and technologies, such as biofuels and other renewable energy solutions.
Used in Research and Development:
Due to its unique chemical structure and properties, 3,6-Dimethyloctanoic acid is used in research and development for the study of biological processes and the development of new applications. This includes its potential use in drug discovery, material science, and other fields of study.
Check Digit Verification of cas no
The CAS Registry Mumber 4812-29-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,1 and 2 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4812-29:
(6*4)+(5*8)+(4*1)+(3*2)+(2*2)+(1*9)=87
87 % 10 = 7
So 4812-29-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H20O2/c1-4-8(2)5-6-9(3)7-10(11)12/h8-9H,4-7H2,1-3H3,(H,11,12)