4812-71-9 Usage
Uses
Used in Pharmaceutical Industry:
(Z)-3-[(4-methyl-1-phenyl-pentan-3-yl)carbamoyl]prop-2-enoic acid is used as a building block for the synthesis of various pharmaceuticals. Its unique structure allows for the creation of a wide range of medicinal compounds, making it a valuable asset in the development of new drugs.
Used in Agrochemical Industry:
In the agrochemical industry, (Z)-3-[(4-methyl-1-phenyl-pentan-3-yl)carbamoyl]prop-2-enoic acid is utilized as a key component in the synthesis of various agrochemicals. Its role in this industry is crucial for the development of effective and targeted solutions for agricultural needs.
Used in Polymer Production:
(Z)-3-[(4-methyl-1-phenyl-pentan-3-yl)carbamoyl]prop-2-enoic acid is also used in the production of various polymer materials. Its incorporation into polymer formulations can enhance the properties of the final product, such as strength, durability, and flexibility.
Used in Research as a Chemical Intermediate:
In the field of research, (Z)-3-[(4-methyl-1-phenyl-pentan-3-yl)carbamoyl]prop-2-enoic acid serves as an important chemical intermediate. Its unique properties make it a valuable tool for scientists and researchers working on the development of new compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 4812-71-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,1 and 2 respectively; the second part has 2 digits, 7 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 4812-71:
(6*4)+(5*8)+(4*1)+(3*2)+(2*7)+(1*1)=89
89 % 10 = 9
So 4812-71-9 is a valid CAS Registry Number.
InChI:InChI=1/C16H21NO3/c1-12(2)14(17-15(18)10-11-16(19)20)9-8-13-6-4-3-5-7-13/h3-7,10-12,14H,8-9H2,1-2H3,(H,17,18)(H,19,20)/b11-10-
