481725-35-3 Usage
Uses
Used in Pharmaceutical Research and Development:
4-Acetyl-3-fluorophenylboronic acid is used as a reagent for Suzuki-Miyaura cross-coupling reactions, which are carbon-carbon bond forming reactions commonly found in the synthesis of organic compounds. Its stability and efficiency as a reagent make it a valuable tool in the synthesis of pharmaceutical compounds, contributing to the development of new drugs and therapeutic agents.
Used in Synthetic Organic Chemistry:
In the field of synthetic organic chemistry, 4-Acetyl-3-fluorophenylboronic acid is used as a key component in various chemical reactions. Its ability to form stable covalent bonds with other molecules allows for the creation of complex organic structures, which are essential in the synthesis of a wide range of chemical products, including potential pharmaceuticals and other specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 481725-35-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,1,7,2 and 5 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 481725-35:
(8*4)+(7*8)+(6*1)+(5*7)+(4*2)+(3*5)+(2*3)+(1*5)=163
163 % 10 = 3
So 481725-35-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H8BFO3/c1-5(11)7-3-2-6(9(12)13)4-8(7)10/h2-4,12-13H,1H3
