482650-81-7 Usage
Uses
Used in Chemical Research:
3H-1,2,4-Triazole-3-thione,5-cyclohexyl-4-ethyl-2,4-dihydro-(9CI) is used as a research compound for exploring its chemical properties and reactivity. Its unique structure, which includes a triazole ring and substituent groups, makes it a candidate for studying various chemical reactions and mechanisms.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 3H-1,2,4-Triazole-3-thione,5-cyclohexyl-4-ethyl-2,4-dihydro-(9CI) may be utilized as a starting material or intermediate in the synthesis of potential drug candidates. Its specific properties, such as the presence of the triazole ring and the cyclohexyl and ethyl groups, could be leveraged to design molecules with desired biological activities, including potential therapeutic applications.
Used in Material Science:
3H-1,2,4-Triazole-3-thione,5-cyclohexyl-4-ethyl-2,4-dihydro-(9CI) could also find applications in material science, where its unique structure and properties might be employed to develop new materials with specific characteristics. For example, it could be used in the design of polymers, coatings, or other materials with tailored properties for various industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 482650-81-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,2,6,5 and 0 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 482650-81:
(8*4)+(7*8)+(6*2)+(5*6)+(4*5)+(3*0)+(2*8)+(1*1)=167
167 % 10 = 7
So 482650-81-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H17N3S/c1-2-13-9(11-12-10(13)14)8-6-4-3-5-7-8/h8H,2-7H2,1H3,(H,12,14)
