4828-13-1 Usage
Uses
Used in Organic Synthesis:
2-(diethoxymethyl)-4,5-dibromofuran serves as a key intermediate in organic synthesis, facilitating the creation of a wide array of complex organic molecules. Its unique structure and reactivity make it an essential component in the synthesis of various compounds.
Used in Pharmaceutical Development:
In the pharmaceutical industry, 2-(diethoxymethyl)-4,5-dibromofuran is utilized as a precursor in the development of new drugs. Its chemical properties allow it to be modified and incorporated into medicinal compounds that target specific biological pathways, potentially leading to the discovery of novel therapeutic agents.
Used in Agrochemical Production:
2-(diethoxymethyl)-4,5-dibromofuran also finds application in the agrochemical sector, where it is employed in the synthesis of pesticides and other agricultural chemicals. Its ability to form stable and effective compounds makes it a valuable asset in creating products that protect crops and enhance agricultural yields.
Used in Specialty Chemicals:
2-(diethoxymethyl)-4,5-dibromofuran is further used in the production of specialty chemicals, which are tailored for specific industries and applications. Its unique properties and reactivity contribute to the development of high-performance materials with specialized functions.
Safety Note:
Due to the presence of bromine atoms, 2-(diethoxymethyl)-4,5-dibromofuran should be handled with care, adhering to strict safety protocols to minimize potential hazards during its use in laboratories and industrial settings.
Check Digit Verification of cas no
The CAS Registry Mumber 4828-13-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,2 and 8 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 4828-13:
(6*4)+(5*8)+(4*2)+(3*8)+(2*1)+(1*3)=101
101 % 10 = 1
So 4828-13-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H12Br2O3/c1-3-12-9(13-4-2)7-5-6(10)8(11)14-7/h5,9H,3-4H2,1-2H3
4828-13-1Relevant academic research and scientific papers
Synthesis of substituted bis(heteroaryl)maleimides
Dubernet, Mathieu,Caubert, Virginie,Guillard, Jér?me,Viaud-Massuard, Marie-Claude
, p. 4585 - 4593 (2007/10/03)
Substituted bis(fur-2-yl), bis(fur-3-yl) and bis(thien-2-yl) maleimides with potential antidiabetic properties are described. Their synthesis involves, as a key step, a Suzuki cross-coupling between various boron derivatives and the diiodomaleimides. Therefore, a wide range of substituted symmetric and non-symmetric maleimide derivatives can be prepared.
