4843-42-9 Usage
General Description
Naphthalen-1-yl-propynoic acid is a chemical compound with the formula C13H10O2. It is a derivative of naphthalene, a polycyclic aromatic hydrocarbon, and contains a propynoic acid functional group. NAPHTHALEN-1-YL-PROPYNOIC ACID has potential applications in various fields, including medicinal chemistry and pharmaceuticals, due to its ability to inhibit the enzyme cyclooxygenase-2 (COX-2) and its anti-inflammatory properties. It may also have uses in the development of new materials and as a building block for the synthesis of other organic compounds. However, further research is needed to fully understand and harness its potential benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 4843-42-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,4 and 3 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 4843-42:
(6*4)+(5*8)+(4*4)+(3*3)+(2*4)+(1*2)=99
99 % 10 = 9
So 4843-42-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H8O2/c14-13(15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,(H,14,15)
