4846-27-9 Usage
Uses
Used in Pharmaceutical Industry:
Gold(+1) cation, 4-hydroxy-4-oxo-2-sulfanyl-butanoate is used as a therapeutic agent for various medical applications, particularly in the treatment of cancer. The gold complex has been shown to exhibit anti-cancer properties by targeting and disrupting essential cellular processes in cancer cells, leading to their growth inhibition and eventual death.
Used in Drug Delivery Systems:
In the field of drug delivery, gold(+1) cation, 4-hydroxy-4-oxo-2-sulfanyl-butanoate is utilized as a component in the development of novel drug delivery systems. These systems aim to improve the bioavailability, targeting, and overall efficacy of various therapeutic agents, including those used in cancer treatment. The unique properties of the gold complex allow for its incorporation into nanoparticles, liposomes, or other carriers to enhance drug delivery and reduce side effects.
Used in Diagnostic Applications:
Gold(+1) cation, 4-hydroxy-4-oxo-2-sulfanyl-butanoate can also be employed in diagnostic applications, such as imaging techniques. The gold complex may be used as a contrast agent in medical imaging, providing enhanced visualization of tumors and other abnormalities due to its unique optical and electronic properties.
Used in Chemical Synthesis:
In the field of chemical synthesis, gold(+1) cation, 4-hydroxy-4-oxo-2-sulfanyl-butanoate serves as a valuable catalyst or intermediate in the production of various organic compounds. The presence of both sulfur and gold in the molecule allows for unique reactivity and selectivity in chemical reactions, enabling the synthesis of complex molecules with potential applications in pharmaceuticals, materials science, and other areas.
Check Digit Verification of cas no
The CAS Registry Mumber 4846-27-9 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,4 and 6 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 4846-27:
(6*4)+(5*8)+(4*4)+(3*6)+(2*2)+(1*7)=109
109 % 10 = 9
So 4846-27-9 is a valid CAS Registry Number.
InChI:InChI=1/C4H6O4S.Au/c5-3(6)1-2(9)4(7)8;/h2,9H,1H2,(H,5,6)(H,7,8);/q;+1/p-1/rC4H5AuO4S/c5-10-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)
