485339-93-3 Usage
Uses
Used in Agricultural Industry:
5-[(4-METHOXYPHENOXY)METHYL]-4-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL is used as a fungicide for its potential antifungal properties, which can help protect crops from fungal infections and diseases, thereby improving crop yield and quality.
Used in Pharmaceutical Industry:
5-[(4-METHOXYPHENOXY)METHYL]-4-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL is used as a drug candidate due to its potential antimicrobial properties, which could be harnessed in the development of new medications to combat microbial infections.
Used in Chemical Synthesis:
5-[(4-METHOXYPHENOXY)METHYL]-4-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL is used as a building block in the synthesis of other compounds with biological activity, contributing to the discovery and development of novel therapeutic agents and pharmaceuticals.
Further research is essential to fully understand and explore the potential uses of 5-[(4-METHOXYPHENOXY)METHYL]-4-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL, ensuring its safe and effective application across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 485339-93-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,5,3,3 and 9 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 485339-93:
(8*4)+(7*8)+(6*5)+(5*3)+(4*3)+(3*9)+(2*9)+(1*3)=193
193 % 10 = 3
So 485339-93-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H13N3O2S/c1-14-10(12-13-11(14)17)7-16-9-5-3-8(15-2)4-6-9/h3-6H,7H2,1-2H3,(H,13,17)
