4854-46-0 Usage
General Description
1-acetamidocyclopentane-1-carboxylic acid, also known as Cyclopentylglycine, is a chemical compound that consists of a cyclopentane ring with a carboxylic acid group and an acetamide group attached. It is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation. 1-acetamidocyclopentane-1-carboxylic acid has been found to exhibit potential pharmacological activity, including as an inhibitor of the enzyme TDP-43 aggregation, which is associated with neurodegenerative diseases such as amyotrophic lateral sclerosis and frontotemporal dementia. Additionally, it has also been investigated for its potential use in the field of medicinal chemistry, particularly as a building block in the synthesis of peptide-based pharmaceuticals. Overall, 1-acetamidocyclopentane-1-carboxylic acid shows promise as a versatile compound with potential applications in both pharmaceutical and medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 4854-46-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,5 and 4 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 4854-46:
(6*4)+(5*8)+(4*5)+(3*4)+(2*4)+(1*6)=110
110 % 10 = 0
So 4854-46-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H13NO3/c1-6(10)9-8(7(11)12)4-2-3-5-8/h2-5H2,1H3,(H,9,10)(H,11,12)
