486997-72-2 Usage
Uses
Used in Pharmaceutical Industry:
3-CHLORO-5-(2-FLUOROBENZYLSULFINYL)-1,2,4-THIADIAZOLE is used as a pharmaceutical agent for its antimicrobial, antifungal, and anticancer properties. Its broad-spectrum biological activities contribute to the development of new drugs targeting various diseases and infections.
Used in Agrochemical Industry:
In the agrochemical industry, 3-CHLORO-5-(2-FLUOROBENZYLSULFINYL)-1,2,4-THIADIAZOLE is used as a bioactive compound for its potential applications in crop protection and pest control. Its antimicrobial and antifungal properties can be harnessed to develop new agrochemicals that protect crops from diseases and pests, thereby increasing agricultural productivity.
Used in Research and Development:
3-CHLORO-5-(2-FLUOROBENZYLSULFINYL)-1,2,4-THIADIAZOLE is also used as a building block in the synthesis of various organic compounds for research and development purposes. Its unique chemical structure allows chemists to explore its potential in creating new molecules with novel properties and applications in various fields, including materials science, medicinal chemistry, and chemical engineering.
Check Digit Verification of cas no
The CAS Registry Mumber 486997-72-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,6,9,9 and 7 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 486997-72:
(8*4)+(7*8)+(6*6)+(5*9)+(4*9)+(3*7)+(2*7)+(1*2)=242
242 % 10 = 2
So 486997-72-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H6ClFN2OS2/c10-8-12-9(15-13-8)16(14)5-6-3-1-2-4-7(6)11/h1-4H,5H2
