486997-73-3 Usage
Uses
Used in Pharmaceutical Industry:
3-CHLORO-5-(3-METHOXYBENZYLSULFINYL)-1,2,4-THIADIAZOLE is used as an intermediate in the synthesis of pharmaceuticals for its potential role in the development of new drugs. Its unique chemical structure allows it to be a valuable component in creating innovative medications.
Used in Agrochemical Industry:
3-CHLORO-5-(3-METHOXYBENZYLSULFINYL)-1,2,4-THIADIAZOLE is also used as an intermediate in the synthesis of agrochemicals, specifically for the development of new pesticides. The presence of the chloro and methoxybenzylsulfinyl groups makes it an attractive candidate for enhancing the effectiveness of pesticides in agricultural applications.
Check Digit Verification of cas no
The CAS Registry Mumber 486997-73-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,6,9,9 and 7 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 486997-73:
(8*4)+(7*8)+(6*6)+(5*9)+(4*9)+(3*7)+(2*7)+(1*3)=243
243 % 10 = 3
So 486997-73-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H9ClN2O2S2/c1-15-8-4-2-3-7(5-8)6-17(14)10-12-9(11)13-16-10/h2-5H,6H2,1H3
