4874-29-7 Usage
Derivative of pyrimidine
The compound is a derivative of pyrimidine, which is a heterocyclic aromatic organic compound This means that the compound is derived from pyrimidine and has a similar structure.
Also known as uracil-5-ol
The compound is a hydroxy derivative of uracil This means that the compound is similar to uracil, but has an additional hydroxyl (-OH) group.
Building block in the synthesis of various pharmaceuticals and agrochemicals
The compound is commonly used as a building block in the synthesis of various pharmaceuticals and agrochemicals This means that the compound is a key ingredient in the production of many drugs and other chemical products.
Potential applications in the development of drugs for the treatment of various diseases and conditions
2(1H)-Pyrimidinone, 5-hydroxy(9CI) has potential applications in the development of drugs for the treatment of various diseases and conditions This means that the compound has the potential to be used in the creation of new medications to treat a variety of illnesses.
Important for researchers and scientists in the pharmaceutical and chemical industries
The compound is important for researchers and scientists in the pharmaceutical and chemical industries This means that the compound is of interest and use to those who study and work with chemicals and drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 4874-29-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,7 and 4 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4874-29:
(6*4)+(5*8)+(4*7)+(3*4)+(2*2)+(1*9)=117
117 % 10 = 7
So 4874-29-7 is a valid CAS Registry Number.
InChI:InChI=1/C4H4N2O2/c7-3-1-5-4(8)6-2-3/h1-2,7H,(H,5,6,8)
