488-02-8 Usage
Uses
1. Used in Pharmaceutical Industry:
Thesinine is used as a pharmaceutical compound for its potential medicinal properties. The alkaloid nature of Thesinine allows it to interact with various biological targets, making it a candidate for the development of new drugs.
2. Used in Chemical Research:
Thesinine serves as a subject of interest in chemical research due to its unique structure and properties. Understanding its chemical behavior and interactions can contribute to the advancement of knowledge in the field of chemistry and related disciplines.
3. Used in Toxicological Studies:
As a pyrrolizidine alkaloid, Thesinine may have toxicological implications. It is used in toxicological studies to understand its effects on living organisms and to develop methods for mitigating any potential harm.
4. Used in Plant Biology and Ecology:
Thesinine, being derived from Thesiurn minkwizianum, is used in plant biology and ecology research to study the plant's defensive mechanisms, ecological roles, and potential applications in agriculture or environmental conservation.
References
Arendaruk, Proskurnina, Konovalova, J. Gen. Chern. USSR, 30, 670 (1960)
Check Digit Verification of cas no
The CAS Registry Mumber 488-02-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,8 and 8 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 488-02:
(5*4)+(4*8)+(3*8)+(2*0)+(1*2)=78
78 % 10 = 8
So 488-02-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H21NO3/c19-15-6-3-13(4-7-15)5-8-17(20)21-12-14-9-11-18-10-1-2-16(14)18/h3-8,14,16,19H,1-2,9-12H2/b8-5+/t14-,16+/m0/s1
488-02-8Relevant academic research and scientific papers
Herrmann, Martina,Joppe, Holger,Schmaus, Gerhard
, p. 399 - 402 (2002)
The glycosylated pyrrolizidine alkaloid, thesinine-4'-O-beta-D-glucoside, has been isolated from the aqueous methanol extract of dried, defatted seeds of Borago officinalis (Boraginaceae). The structure was established by means of spectroscopic and chemic