4894-29-5 Usage
Uses
Used in Pharmaceutical Industry:
6-Chloro-4-methyl-7-azaindole is used as a building block for the synthesis of various biologically active molecules, contributing to the development of new drugs with therapeutic properties. Its unique structure allows for the creation of diverse compounds with potential medicinal applications.
Used in Research:
6-Chloro-4-methyl-7-azaindole is utilized as a reagent in the preparation of novel heterocyclic compounds, expanding the scope of chemical research and the discovery of new chemical entities with potential applications in various fields.
Safety Precautions:
It is crucial to handle 6-Chloro-4-methyl-7-azaindole with care due to its potential hazards. Proper safety measures should be followed during its handling, storage, and use to minimize risks and ensure the well-being of individuals involved in its manipulation.
Check Digit Verification of cas no
The CAS Registry Mumber 4894-29-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,8,9 and 4 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 4894-29:
(6*4)+(5*8)+(4*9)+(3*4)+(2*2)+(1*9)=125
125 % 10 = 5
So 4894-29-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H7ClN2/c1-5-4-7(9)11-8-6(5)2-3-10-8/h2-4H,1H3,(H,10,11)
