490-96-0 Usage
Uses
1. Used in Pharmaceutical Industry:
[(3R,7R)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 3-methylbutan oate is used as an active pharmaceutical ingredient for its potential therapeutic applications. [(3R,7R)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 3-methylbutan oate's unique structure and properties make it a promising candidate for the development of new drugs targeting various medical conditions.
2. Used in Chemical Research:
[(3R,7R)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 3-methylbutan oate is also used as a research tool in the field of organic chemistry, particularly for studying the synthesis, structure, and reactivity of alkaloids and related compounds. Its various derivatives and the reactions it undergoes provide valuable insights into the chemical behavior of similar molecules.
3. Used in Drug Synthesis:
[(3R,7R)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 3-methylbutan oate can be employed as a key intermediate in the synthesis of other bioactive compounds, including potential drug candidates. Its versatile chemistry allows for the development of novel therapeutic agents with improved pharmacological properties.
4. Used in Analytical Chemistry:
[(3R,7R)-7-hydroxy-8-methyl-8-azabicyclo[3.2.1]oct-3-yl] 3-methylbutan oate's distinct optical rotation values and characteristic derivatives make it useful in analytical chemistry for the identification and quantification of alkaloids in various samples, such as plant extracts or pharmaceutical formulations.
References
Barger, Martin, Mitchell.,!. Chem. Soc., 1820 (1937)
Barger, Martin, Mitchell., ibid, 1685 (1938)
Martin, Mitchell., ibid, 1155 (I 940)
Mitchell, Troutner., ibid, 1330 (I 947)
Fodor, Kovacs., ibid, 2341 (1953)
Fodor, Vincze, Toth., ibid, 1349 (1957)
Fodor, Vincze, Toth., ibid, 3219 (1961)
Check Digit Verification of cas no
The CAS Registry Mumber 490-96-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,9 and 0 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 490-96:
(5*4)+(4*9)+(3*0)+(2*9)+(1*6)=80
80 % 10 = 0
So 490-96-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H23NO3/c1-8(2)4-13(16)17-10-5-9-6-12(15)11(7-10)14(9)3/h8-12,15H,4-7H2,1-3H3/t9?,10-,11?,12-/m1/s1
490-96-0Relevant academic research and scientific papers
A novel and versatile method for the enantioselective syntheses of tropane alkaloids
Mao, Zhongyi,Huang, Suyu,Gao, Longhui,Wang, Aie,Huang, Peiqiang
, p. 252 - 264 (2014/03/21)
A full account of the novel and flexible approach to hydroxylated 8-azabicyclo[3,2,1]octan-3-ones and 9-azabicyclo[3,3,1] nonan-3-ones is presented. Using keto-lactams as the starting materials, this two-step method consists of silyl enol ether formation with TBDMSOTf, lactam activation with Tf2O/DTBMP, and halide-promoted cyclization. Radical dechlorination of the resulting 1-halotropan-3-ones led to the corresponding hydroxylated tropan-3-ones, which can be hydrogenated to yield 3α,6β- dihydroxytropanes. Starting from optically active keto-lactams, the method has been applied to the enantioselective syntheses of (+)-(1S,3S,5R,6S)-pervilleine C (6), (+)-(1S,3R,5S,6R)-valeroidine (3), (+)-(1S,3S,5R,6S)-dibenzoyloxytropane (8), and (+)-(1S,3S,5R,6S)-merredissine (9).
