49669-74-1

Usage

Uses

Used in Pharmaceutical Research and Development:
[S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is utilized as a building block in the pharmaceutical industry for the development of new drugs and therapeutic agents. Its unique structure and properties make it a promising candidate for the creation of novel compounds with potential medicinal applications.
Used in Biochemical Studies:
In the field of biochemistry, [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is employed as a subject of study to explore its potential biological activities and interactions with other molecules. This research can lead to a better understanding of its role in biological systems and the discovery of new applications in medicine and other related fields.
Used in Drug Design and Synthesis:
[S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid is used as a key component in drug design and synthesis processes. Its incorporation into new molecular structures can enhance the efficacy and selectivity of drugs, potentially leading to the development of more effective treatments for various diseases and conditions.
Used in Chemical Synthesis for Diverse Applications:
Beyond the pharmaceutical and biochemical fields, [S-(E)]-2-amino-4-(2-aminoethoxy)-3-butenoic acid can be utilized in chemical synthesis for a variety of applications. Its unique structure allows for the creation of new compounds that can be applied in industries such as materials science, agriculture, and environmental science, among others.

InChI:InChI=1/C6H12N2O3/c7-2-4-11-3-1-5(8)6(9)10/h1,3,5H,2,4,7-8H2,(H,9,10)/b3-1+/t5-/m0/s1