49670-63-5 Usage
Uses
Used in Dye and Pigment Manufacturing:
2,3-Diaminofluorene is used as a key intermediate in the production of various dyes and pigments. Its unique chemical structure allows for the creation of a wide range of colors, making it valuable in the dye and pigment industry.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 2,3-Diaminofluorene serves as a building block for the synthesis of various drugs. Its reactivity and functional groups enable the development of new pharmaceutical compounds with potential therapeutic applications.
Used in Pesticide Production:
2,3-Diaminofluorene is also utilized in the manufacturing of certain pesticides. Its chemical properties make it suitable for the development of effective pest control agents, contributing to agricultural productivity and crop protection.
However, due to its toxicological properties, the use of 2,3-diaminofluorene is closely monitored and regulated in industrial settings. Strict safety measures and guidelines are implemented to prevent adverse effects on human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 49670-63-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,9,6,7 and 0 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 49670-63:
(7*4)+(6*9)+(5*6)+(4*7)+(3*0)+(2*6)+(1*3)=155
155 % 10 = 5
So 49670-63-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H12N2/c14-12-6-9-5-8-3-1-2-4-10(8)11(9)7-13(12)15/h1-4,6-7H,5,14-15H2
