49834-62-0 Usage
Uses
Used in Medicinal Chemistry:
1H-Pyrazolo[3,4-b]pyridin-4-amine is used as a kinase inhibitor for its potential role in the development of new therapeutic agents. Its unique structure and properties make it a valuable molecule for research in drug discovery and development, particularly for targeting specific kinases implicated in various diseases.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1H-Pyrazolo[3,4-b]pyridin-4-amine serves as a building block in the synthesis of various organic compounds. Its incorporation into the design of new drugs can lead to the creation of innovative treatments for a range of medical conditions, capitalizing on its potential as a kinase inhibitor and its ability to be modified for specific therapeutic targets.
Used in Drug Discovery:
1H-Pyrazolo[3,4-b]pyridin-4-amine is utilized in drug discovery as a starting point for the development of novel compounds with potential therapeutic effects. Its unique structure allows for further chemical modifications, enabling researchers to explore its interactions with biological targets and optimize its properties for specific applications in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 49834-62-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,9,8,3 and 4 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 49834-62:
(7*4)+(6*9)+(5*8)+(4*3)+(3*4)+(2*6)+(1*2)=160
160 % 10 = 0
So 49834-62-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N4/c7-5-1-2-8-6-4(5)3-9-10-6/h1-3H,(H3,7,8,9,10)
